C13H22F2 — CID 155183670
(4Z)-4-(4,4-difluorobutan-2-yl)-2,6-dimethylhepta-2,4-diene (PubChem CID 155183670) has the molecular formula C13H22F2 and a molecular weight of 216.31 g/mol. Its IUPAC name is (4Z)-4-(4,4-difluorobutan-2-yl)-2,6-dimethylhepta-2,4-diene.
| Compound Name | (4Z)-4-(4,4-difluorobutan-2-yl)-2,6-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 155183670 |
| Molecular Formula | C13H22F2 |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (4Z)-4-(4,4-difluorobutan-2-yl)-2,6-dimethylhepta-2,4-diene |
| SMILES | CC(C)=C/C(=C\C(C)C)C(C)CC(F)F |
| InChI | InChI=1S/C13H22F2/c1-9(2)6-12(7-10(3)4)11(5)8-13(14)15/h6-7,9,11,13H,8H2,1-5H3/b12-6+ |
| InChIKey | BGTCEEAQYKRWDS-WUXMJOGZSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|