C6H12F2N2 — CID 131134560
N'-(4,4-difluorobutan-2-yl)ethanimidamide (PubChem CID 131134560) has the molecular formula C6H12F2N2 and a molecular weight of 150.17 g/mol. Its IUPAC name is N'-(4,4-difluorobutan-2-yl)ethanimidamide.
| Compound Name | N'-(4,4-difluorobutan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 131134560 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | N'-(4,4-difluorobutan-2-yl)ethanimidamide |
| SMILES | C/C(N)=N\C(C)CC(F)F |
| InChI | InChI=1S/C6H12F2N2/c1-4(3-6(7)8)10-5(2)9/h4,6H,3H2,1-2H3,(H2,9,10) |
| InChIKey | JRDIKHRTOZDBLF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|