C7H15N3OS2 — CID 21120256
4-(diaminomethylideneamino)-2-(sulfanylmethyl)pentanethioic S-acid (PubChem CID 21120256) has the molecular formula C7H15N3OS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-2-(sulfanylmethyl)pentanethioic S-acid.
| Compound Name | 4-(diaminomethylideneamino)-2-(sulfanylmethyl)pentanethioic S-acid |
|---|---|
| PubChem CID | 21120256 |
| Molecular Formula | C7H15N3OS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(diaminomethylideneamino)-2-(sulfanylmethyl)pentanethioic S-acid |
| SMILES | CC(CC(CS)C(=O)S)N=C(N)N |
| InChI | InChI=1S/C7H15N3OS2/c1-4(10-7(8)9)2-5(3-12)6(11)13/h4-5,12H,2-3H2,1H3,(H,11,13)(H4,8,9,10) |
| InChIKey | WSUFLMTVPZORDB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|