C7H15NOS2 — CID 90740690
4-sulfanyl-2-(sulfanylmethyl)hexanamide (PubChem CID 90740690) has the molecular formula C7H15NOS2 and a molecular weight of 193.34 g/mol. Its IUPAC name is 4-sulfanyl-2-(sulfanylmethyl)hexanamide.
| Compound Name | 4-sulfanyl-2-(sulfanylmethyl)hexanamide |
|---|---|
| PubChem CID | 90740690 |
| Molecular Formula | C7H15NOS2 |
| Molecular Weight | 193.34 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 4-sulfanyl-2-(sulfanylmethyl)hexanamide |
| SMILES | CCC(S)CC(CS)C(N)=O |
| InChI | InChI=1S/C7H15NOS2/c1-2-6(11)3-5(4-10)7(8)9/h5-6,10-11H,2-4H2,1H3,(H2,8,9) |
| InChIKey | QKDYUUWCSINLDQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|