C11H21NO4S — CID 88551575
(2-hydroxy-3-sulfanylpropyl) 4-carbamoyl-2-methylhexanoate (PubChem CID 88551575) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is (2-hydroxy-3-sulfanylpropyl) 4-carbamoyl-2-methylhexanoate.
| Compound Name | (2-hydroxy-3-sulfanylpropyl) 4-carbamoyl-2-methylhexanoate |
|---|---|
| PubChem CID | 88551575 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2-hydroxy-3-sulfanylpropyl) 4-carbamoyl-2-methylhexanoate |
| SMILES | CCC(CC(C)C(=O)OCC(O)CS)C(N)=O |
| InChI | InChI=1S/C11H21NO4S/c1-3-8(10(12)14)4-7(2)11(15)16-5-9(13)6-17/h7-9,13,17H,3-6H2,1-2H3,(H2,12,14) |
| InChIKey | DBGKXPNZCBHFDQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|