C13H27ClN2O3 — CID 91142692
2-(4-carbamoyl-2-methylhexanoyl)oxyethyl-trimethylazanium chloride (PubChem CID 91142692) has the molecular formula C13H27ClN2O3 and a molecular weight of 294.82 g/mol. Its IUPAC name is 2-(4-carbamoyl-2-methylhexanoyl)oxyethyl-trimethylazanium chloride.
| Compound Name | 2-(4-carbamoyl-2-methylhexanoyl)oxyethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 91142692 |
| Molecular Formula | C13H27ClN2O3 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(4-carbamoyl-2-methylhexanoyl)oxyethyl-trimethylazanium chloride |
| SMILES | CCC(CC(C)C(=O)OCC[N+](C)(C)C)C(N)=O.[Cl-] |
| InChI | InChI=1S/C13H26N2O3.ClH/c1-6-11(12(14)16)9-10(2)13(17)18-8-7-15(3,4)5;/h10-11H,6-9H2,1-5H3,(H-,14,16);1H |
| InChIKey | QGJMTYWFIYLDHC-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|