About 2-hydroxybutanamide;hydrochloride
2-hydroxybutanamide;hydrochloride (PubChem CID 87384831) has the molecular formula C4H10ClNO2
and a molecular weight of 139.58 g/mol. Its IUPAC name is 2-hydroxybutanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-hydroxybutanamide;hydrochloride |
| PubChem CID | 87384831 |
| Molecular Formula | C4H10ClNO2 |
| Molecular Weight | 139.58 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | 2-hydroxybutanamide;hydrochloride |
| SMILES | CCC(O)C(N)=O.Cl |
| InChI | InChI=1S/C4H9NO2.ClH/c1-2-3(6)4(5)7;/h3,6H,2H2,1H3,(H2,5,7);1H |
| InChIKey | LNBGSVMBPDUCAE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.58 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxybutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanamide;hydrochloride?
The IUPAC name of 2-hydroxybutanamide;hydrochloride (CID 87384831) is 2-hydroxybutanamide;hydrochloride.
What is the SMILES notation for 2-hydroxybutanamide;hydrochloride?
The canonical SMILES for 2-hydroxybutanamide;hydrochloride is CCC(O)C(N)=O.Cl.
What is the InChIKey of 2-hydroxybutanamide;hydrochloride?
The InChIKey is LNBGSVMBPDUCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.ClH/c1-2-3(6)4(5)7;/h3,6H,2H2,1H3,(H2,5,7);1H.
What are the key properties of 2-hydroxybutanamide;hydrochloride?
2-hydroxybutanamide;hydrochloride has a molecular weight of 139.58 g/mol, XLogP of -0.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanamide;hydrochloride is sourced from PubChem (CID 87384831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).