About 3-hydroxypentan-2-one;zinc
3-hydroxypentan-2-one;zinc (PubChem CID 174642767) has the molecular formula C5H10O2Zn
and a molecular weight of 167.52 g/mol. Its IUPAC name is 3-hydroxypentan-2-one;zinc.
Molecular Properties
| Compound Name | 3-hydroxypentan-2-one;zinc |
| PubChem CID | 174642767 |
| Molecular Formula | C5H10O2Zn |
| Molecular Weight | 167.52 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 3-hydroxypentan-2-one;zinc |
| SMILES | CCC(O)C(C)=O.[Zn] |
| InChI | InChI=1S/C5H10O2.Zn/c1-3-5(7)4(2)6;/h5,7H,3H2,1-2H3; |
| InChIKey | HGGNZVLQCXNXLO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.52 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypentan-2-one;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypentan-2-one;zinc?
The IUPAC name of 3-hydroxypentan-2-one;zinc (CID 174642767) is 3-hydroxypentan-2-one;zinc.
What is the SMILES notation for 3-hydroxypentan-2-one;zinc?
The canonical SMILES for 3-hydroxypentan-2-one;zinc is CCC(O)C(C)=O.[Zn].
What is the InChIKey of 3-hydroxypentan-2-one;zinc?
The InChIKey is HGGNZVLQCXNXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.Zn/c1-3-5(7)4(2)6;/h5,7H,3H2,1-2H3;.
What are the key properties of 3-hydroxypentan-2-one;zinc?
3-hydroxypentan-2-one;zinc has a molecular weight of 167.52 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypentan-2-one;zinc is sourced from PubChem (CID 174642767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).