C19H40O5 — CID 167591324
ethane;8-hydroxydecane-2,5-dione;3-hydroxypentan-2-one (PubChem CID 167591324) has the molecular formula C19H40O5 and a molecular weight of 348.52 g/mol. Its IUPAC name is ethane;8-hydroxydecane-2,5-dione;3-hydroxypentan-2-one.
| Compound Name | ethane;8-hydroxydecane-2,5-dione;3-hydroxypentan-2-one |
|---|---|
| PubChem CID | 167591324 |
| Molecular Formula | C19H40O5 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | ethane;8-hydroxydecane-2,5-dione;3-hydroxypentan-2-one |
| SMILES | CC.CC.CCC(O)C(C)=O.CCC(O)CCC(=O)CCC(C)=O |
| InChI | InChI=1S/C10H18O3.C5H10O2.2C2H6/c1-3-9(12)6-7-10(13)5-4-8(2)11;1-3-5(7)4(2)6;2*1-2/h9,12H,3-7H2,1-2H3;5,7H,3H2,1-2H3;2*1-2H3 |
| InChIKey | ILXZGGZXKFGXPV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |