About 3,5-dihydroxyheptan-2-one
3,5-dihydroxyheptan-2-one (PubChem CID 139533007) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3,5-dihydroxyheptan-2-one.
Molecular Properties
| Compound Name | 3,5-dihydroxyheptan-2-one |
| PubChem CID | 139533007 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3,5-dihydroxyheptan-2-one |
| SMILES | CCC(O)CC(O)C(C)=O |
| InChI | InChI=1S/C7H14O3/c1-3-6(9)4-7(10)5(2)8/h6-7,9-10H,3-4H2,1-2H3 |
| InChIKey | NPFGISWRVYDDNG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dihydroxyheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxyheptan-2-one?
The IUPAC name of 3,5-dihydroxyheptan-2-one (CID 139533007) is 3,5-dihydroxyheptan-2-one.
What is the SMILES notation for 3,5-dihydroxyheptan-2-one?
The canonical SMILES for 3,5-dihydroxyheptan-2-one is CCC(O)CC(O)C(C)=O.
What is the InChIKey of 3,5-dihydroxyheptan-2-one?
The InChIKey is NPFGISWRVYDDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-3-6(9)4-7(10)5(2)8/h6-7,9-10H,3-4H2,1-2H3.
What are the key properties of 3,5-dihydroxyheptan-2-one?
3,5-dihydroxyheptan-2-one has a molecular weight of 146.19 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxyheptan-2-one is sourced from PubChem (CID 139533007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).