C7H14N2O2S2 — CID 158260312
(2S,5R)-5-amino-4-oxo-6-sulfanyl-2-(sulfanylmethyl)hexanamide (PubChem CID 158260312) has the molecular formula C7H14N2O2S2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2S,5R)-5-amino-4-oxo-6-sulfanyl-2-(sulfanylmethyl)hexanamide.
| Compound Name | (2S,5R)-5-amino-4-oxo-6-sulfanyl-2-(sulfanylmethyl)hexanamide |
|---|---|
| PubChem CID | 158260312 |
| Molecular Formula | C7H14N2O2S2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (2S,5R)-5-amino-4-oxo-6-sulfanyl-2-(sulfanylmethyl)hexanamide |
| SMILES | NC(=O)C(CS)CC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C7H14N2O2S2/c8-5(3-13)6(10)1-4(2-12)7(9)11/h4-5,12-13H,1-3,8H2,(H2,9,11)/t4?,5-/m0/s1 |
| InChIKey | HEDRKPGUOLSKLS-AKGZTFGVSA-N |
| XLogP | -0.77 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|