C3H9N3S2 — CID 91116888
2-[1,2-bis(sulfanyl)ethyl]guanidine (PubChem CID 91116888) has the molecular formula C3H9N3S2 and a molecular weight of 151.26 g/mol. Its IUPAC name is 2-[1,2-bis(sulfanyl)ethyl]guanidine.
| Compound Name | 2-[1,2-bis(sulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 91116888 |
| Molecular Formula | C3H9N3S2 |
| Molecular Weight | 151.26 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 2-[1,2-bis(sulfanyl)ethyl]guanidine |
| SMILES | NC(N)=NC(S)CS |
| InChI | InChI=1S/C3H9N3S2/c4-3(5)6-2(8)1-7/h2,7-8H,1H2,(H4,4,5,6) |
| InChIKey | LCJXZPMPYBHLII-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|