C6H16N2O7P2 — CID 23196090
[3-(1-aminoethylideneamino)-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 23196090) has the molecular formula C6H16N2O7P2 and a molecular weight of 290.15 g/mol. Its IUPAC name is [3-(1-aminoethylideneamino)-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [3-(1-aminoethylideneamino)-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 23196090 |
| Molecular Formula | C6H16N2O7P2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | [3-(1-aminoethylideneamino)-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | C/C(N)=N\C(C)CC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H16N2O7P2/c1-4(8-5(2)7)3-6(9,16(10,11)12)17(13,14)15/h4,9H,3H2,1-2H3,(H2,7,8)(H2,10,11,12)(H2,13,14,15) |
| InChIKey | SNLYHIUVKGHJCT-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 173.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|