C10H29N3O7P2 — CID 174676436
(4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hexane-1,5-diamine (PubChem CID 174676436) has the molecular formula C10H29N3O7P2 and a molecular weight of 365.30 g/mol. Its IUPAC name is (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hexane-1,5-diamine.
| Compound Name | (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hexane-1,5-diamine |
|---|---|
| PubChem CID | 174676436 |
| Molecular Formula | C10H29N3O7P2 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hexane-1,5-diamine |
| SMILES | CC(N)CCCCN.NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H16N2.C4H13NO7P2/c1-6(8)4-2-3-5-7;5-3-1-2-4(6,13(7,8)9)14(10,11)12/h6H,2-5,7-8H2,1H3;6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12) |
| InChIKey | MYCGZKJHKNQXIH-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 213.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|