C4H14N4O7P2 — CID 130206263
CID 130206263 (PubChem CID 130206263) has the molecular formula C4H14N4O7P2 and a molecular weight of 292.13 g/mol.
| Compound Name | CID 130206263 |
|---|---|
| PubChem CID | 130206263 |
| Molecular Formula | C4H14N4O7P2 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | — |
| SMILES | NCCCC(O)(P(=O)(O)O)P(=O)(O)O.[N-]=[N+]=N |
| InChI | InChI=1S/C4H13NO7P2.HN3/c5-3-1-2-4(6,13(7,8)9)14(10,11)12;1-3-2/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12);1H |
| InChIKey | YYJKAQVTZDNTLN-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 221.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|