About CID 130206263
CID 130206263 (PubChem CID 130206263) has the molecular formula C4H14N4O7P2
and a molecular weight of 292.13 g/mol.
Molecular Properties
| Compound Name | CID 130206263 |
| PubChem CID | 130206263 |
| Molecular Formula | C4H14N4O7P2 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | — |
| SMILES | NCCCC(O)(P(=O)(O)O)P(=O)(O)O.[N-]=[N+]=N |
| InChI | InChI=1S/C4H13NO7P2.HN3/c5-3-1-2-4(6,13(7,8)9)14(10,11)12;1-3-2/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12);1H |
| InChIKey | YYJKAQVTZDNTLN-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 221.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 130206263 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 130206263?
The IUPAC name of CID 130206263 (CID 130206263) is not available.
What is the SMILES notation for CID 130206263?
The canonical SMILES for CID 130206263 is NCCCC(O)(P(=O)(O)O)P(=O)(O)O.[N-]=[N+]=N.
What is the InChIKey of CID 130206263?
The InChIKey is YYJKAQVTZDNTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13NO7P2.HN3/c5-3-1-2-4(6,13(7,8)9)14(10,11)12;1-3-2/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12);1H.
What are the key properties of CID 130206263?
CID 130206263 has a molecular weight of 292.13 g/mol, XLogP of -0.40, 5 rotatable bonds, 7 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 130206263 is sourced from PubChem (CID 130206263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).