C4H13NO7P2 — CID 2088
View drug profile → alendronic acid(4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid (PubChem CID 2088) has the molecular formula C4H13NO7P2 and a molecular weight of 249.10 g/mol. Its IUPAC name is (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid.
| Compound Name | (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid |
|---|---|
| PubChem CID | 2088 |
| Molecular Formula | C4H13NO7P2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid |
| SMILES | NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H13NO7P2/c5-3-1-2-4(6,13(7,8)9)14(10,11)12/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12) |
| InChIKey | OGSPWJRAVKPPFI-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|