C6H13O14P3 — CID 57041307
2-(2-hydroxy-2,2-diphosphonoethyl)-3-phosphonobutanedioic acid (PubChem CID 57041307) has the molecular formula C6H13O14P3 and a molecular weight of 402.08 g/mol. Its IUPAC name is 2-(2-hydroxy-2,2-diphosphonoethyl)-3-phosphonobutanedioic acid.
| Compound Name | 2-(2-hydroxy-2,2-diphosphonoethyl)-3-phosphonobutanedioic acid |
|---|---|
| PubChem CID | 57041307 |
| Molecular Formula | C6H13O14P3 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 2-(2-hydroxy-2,2-diphosphonoethyl)-3-phosphonobutanedioic acid |
| SMILES | O=C(O)C(CC(O)(P(=O)(O)O)P(=O)(O)O)C(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H13O14P3/c7-4(8)2(3(5(9)10)21(12,13)14)1-6(11,22(15,16)17)23(18,19)20/h2-3,11H,1H2,(H,7,8)(H,9,10)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | SNICLWBYKCHXKU-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 267.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|