C13H24NO7P — CID 19955333
2-phosphono-3-(5-pyrrolidin-1-ylpentyl)butanedioic acid (PubChem CID 19955333) has the molecular formula C13H24NO7P and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-phosphono-3-(5-pyrrolidin-1-ylpentyl)butanedioic acid.
| Compound Name | 2-phosphono-3-(5-pyrrolidin-1-ylpentyl)butanedioic acid |
|---|---|
| PubChem CID | 19955333 |
| Molecular Formula | C13H24NO7P |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-phosphono-3-(5-pyrrolidin-1-ylpentyl)butanedioic acid |
| SMILES | O=C(O)C(CCCCCN1CCCC1)C(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H24NO7P/c15-12(16)10(11(13(17)18)22(19,20)21)6-2-1-3-7-14-8-4-5-9-14/h10-11H,1-9H2,(H,15,16)(H,17,18)(H2,19,20,21) |
| InChIKey | AGIHZRIUIFPYGF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|