C12H22NO7P — CID 19955313
2-phosphono-3-(4-pyrrolidin-1-ylbutyl)butanedioic acid (PubChem CID 19955313) has the molecular formula C12H22NO7P and a molecular weight of 323.28 g/mol. Its IUPAC name is 2-phosphono-3-(4-pyrrolidin-1-ylbutyl)butanedioic acid.
| Compound Name | 2-phosphono-3-(4-pyrrolidin-1-ylbutyl)butanedioic acid |
|---|---|
| PubChem CID | 19955313 |
| Molecular Formula | C12H22NO7P |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-phosphono-3-(4-pyrrolidin-1-ylbutyl)butanedioic acid |
| SMILES | O=C(O)C(CCCCN1CCCC1)C(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H22NO7P/c14-11(15)9(10(12(16)17)21(18,19)20)5-1-2-6-13-7-3-4-8-13/h9-10H,1-8H2,(H,14,15)(H,16,17)(H2,18,19,20) |
| InChIKey | KMGYSPZNFFDVCJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|