C12H16NO7P — CID 19955315
2-phosphono-3-(2-pyridin-2-ylpropyl)butanedioic acid (PubChem CID 19955315) has the molecular formula C12H16NO7P and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-phosphono-3-(2-pyridin-2-ylpropyl)butanedioic acid.
| Compound Name | 2-phosphono-3-(2-pyridin-2-ylpropyl)butanedioic acid |
|---|---|
| PubChem CID | 19955315 |
| Molecular Formula | C12H16NO7P |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-phosphono-3-(2-pyridin-2-ylpropyl)butanedioic acid |
| SMILES | CC(CC(C(=O)O)C(C(=O)O)P(=O)(O)O)c1ccccn1 |
| InChI | InChI=1S/C12H16NO7P/c1-7(9-4-2-3-5-13-9)6-8(11(14)15)10(12(16)17)21(18,19)20/h2-5,7-8,10H,6H2,1H3,(H,14,15)(H,16,17)(H2,18,19,20) |
| InChIKey | TZYLZTPNIAWDRO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|