C15H17NO7P2 — CID 19975357
(4-oxo-4-phenyl-1-phosphono-3-pyridin-2-ylbutyl)phosphonic acid (PubChem CID 19975357) has the molecular formula C15H17NO7P2 and a molecular weight of 385.25 g/mol. Its IUPAC name is (4-oxo-4-phenyl-1-phosphono-3-pyridin-2-ylbutyl)phosphonic acid.
| Compound Name | (4-oxo-4-phenyl-1-phosphono-3-pyridin-2-ylbutyl)phosphonic acid |
|---|---|
| PubChem CID | 19975357 |
| Molecular Formula | C15H17NO7P2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (4-oxo-4-phenyl-1-phosphono-3-pyridin-2-ylbutyl)phosphonic acid |
| SMILES | O=C(c1ccccc1)C(CC(P(=O)(O)O)P(=O)(O)O)c1ccccn1 |
| InChI | InChI=1S/C15H17NO7P2/c17-15(11-6-2-1-3-7-11)12(13-8-4-5-9-16-13)10-14(24(18,19)20)25(21,22)23/h1-9,12,14H,10H2,(H2,18,19,20)(H2,21,22,23) |
| InChIKey | PLDTUJJDCAUISV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|