C4H12O8P2 — CID 54221090
(1-dimethoxyphosphoryl-1,2-dihydroxyethyl)phosphonic acid (PubChem CID 54221090) has the molecular formula C4H12O8P2 and a molecular weight of 250.08 g/mol. Its IUPAC name is (1-dimethoxyphosphoryl-1,2-dihydroxyethyl)phosphonic acid.
| Compound Name | (1-dimethoxyphosphoryl-1,2-dihydroxyethyl)phosphonic acid |
|---|---|
| PubChem CID | 54221090 |
| Molecular Formula | C4H12O8P2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | (1-dimethoxyphosphoryl-1,2-dihydroxyethyl)phosphonic acid |
| SMILES | COP(=O)(OC)C(O)(CO)P(=O)(O)O |
| InChI | InChI=1S/C4H12O8P2/c1-11-14(10,12-2)4(6,3-5)13(7,8)9/h5-6H,3H2,1-2H3,(H2,7,8,9) |
| InChIKey | QCQQBPSFMMILOV-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|