C4H13NO7P2 — CID 139914990
[3-amino-1-hydroxy-1-[hydroxy(methoxy)phosphoryl]propyl]phosphonic acid (PubChem CID 139914990) has the molecular formula C4H13NO7P2 and a molecular weight of 249.10 g/mol. Its IUPAC name is [3-amino-1-hydroxy-1-[hydroxy(methoxy)phosphoryl]propyl]phosphonic acid.
| Compound Name | [3-amino-1-hydroxy-1-[hydroxy(methoxy)phosphoryl]propyl]phosphonic acid |
|---|---|
| PubChem CID | 139914990 |
| Molecular Formula | C4H13NO7P2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | [3-amino-1-hydroxy-1-[hydroxy(methoxy)phosphoryl]propyl]phosphonic acid |
| SMILES | COP(=O)(O)C(O)(CCN)P(=O)(O)O |
| InChI | InChI=1S/C4H13NO7P2/c1-12-14(10,11)4(6,2-3-5)13(7,8)9/h6H,2-3,5H2,1H3,(H,10,11)(H2,7,8,9) |
| InChIKey | SPTPFKIRBIWSJO-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|