C15H19NO7P2 — CID 16754559
[3-amino-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]propyl]-phenoxyphosphinic acid (PubChem CID 16754559) has the molecular formula C15H19NO7P2 and a molecular weight of 387.26 g/mol. Its IUPAC name is [3-amino-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]propyl]-phenoxyphosphinic acid.
| Compound Name | [3-amino-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]propyl]-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 16754559 |
| Molecular Formula | C15H19NO7P2 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | [3-amino-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]propyl]-phenoxyphosphinic acid |
| SMILES | NCCC(O)(P(=O)(O)Oc1ccccc1)P(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C15H19NO7P2/c16-12-11-15(17,24(18,19)22-13-7-3-1-4-8-13)25(20,21)23-14-9-5-2-6-10-14/h1-10,17H,11-12,16H2,(H,18,19)(H,20,21) |
| InChIKey | HINZFKLXYXIUPV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|