C24H23NO9P2 — CID 16754557
[4-(1,3-dioxoisoindol-2-yl)-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]butyl]-phenoxyphosphinic acid (PubChem CID 16754557) has the molecular formula C24H23NO9P2 and a molecular weight of 531.39 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]butyl]-phenoxyphosphinic acid.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]butyl]-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 16754557 |
| Molecular Formula | C24H23NO9P2 |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)-1-hydroxy-1-[hydroxy(phenoxy)phosphoryl]butyl]-phenoxyphosphinic acid |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC(O)(P(=O)(O)Oc1ccccc1)P(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C24H23NO9P2/c26-22-20-14-7-8-15-21(20)23(27)25(22)17-9-16-24(28,35(29,30)33-18-10-3-1-4-11-18)36(31,32)34-19-12-5-2-6-13-19/h1-8,10-15,28H,9,16-17H2,(H,29,30)(H,31,32) |
| InChIKey | CIKZYRKDAMEZQM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|