C26H23N2O5P — CID 102187871
2-(5-diphenoxyphosphoryl-5-isocyanopentyl)isoindole-1,3-dione (PubChem CID 102187871) has the molecular formula C26H23N2O5P and a molecular weight of 474.45 g/mol. Its IUPAC name is 2-(5-diphenoxyphosphoryl-5-isocyanopentyl)isoindole-1,3-dione.
| Compound Name | 2-(5-diphenoxyphosphoryl-5-isocyanopentyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 102187871 |
| Molecular Formula | C26H23N2O5P |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-(5-diphenoxyphosphoryl-5-isocyanopentyl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]C(CCCCN1C(=O)c2ccccc2C1=O)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H23N2O5P/c1-27-24(18-10-11-19-28-25(29)22-16-8-9-17-23(22)26(28)30)34(31,32-20-12-4-2-5-13-20)33-21-14-6-3-7-15-21/h2-9,12-17,24H,10-11,18-19H2 |
| InChIKey | RDHIUXSHUHAVIK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|