C26H24N2O5 — CID 175108064
[(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(4-phenoxyphenyl)pentyl] carbamate (PubChem CID 175108064) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(4-phenoxyphenyl)pentyl] carbamate.
| Compound Name | [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(4-phenoxyphenyl)pentyl] carbamate |
|---|---|
| PubChem CID | 175108064 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(4-phenoxyphenyl)pentyl] carbamate |
| SMILES | NC(=O)O[C@@H](CCCCN1C(=O)c2ccccc2C1=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O5/c27-26(31)33-23(18-13-15-20(16-14-18)32-19-8-2-1-3-9-19)12-6-7-17-28-24(29)21-10-4-5-11-22(21)25(28)30/h1-5,8-11,13-16,23H,6-7,12,17H2,(H2,27,31)/t23-/m0/s1 |
| InChIKey | YPVARODWAVTNII-QHCPKHFHSA-N |
| XLogP | 5.08 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|