About (2-amino-1-phenylethyl) carbamate
(2-amino-1-phenylethyl) carbamate (PubChem CID 57066991) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is (2-amino-1-phenylethyl) carbamate.
Molecular Properties
| Compound Name | (2-amino-1-phenylethyl) carbamate |
| PubChem CID | 57066991 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2-amino-1-phenylethyl) carbamate |
| SMILES | NCC(OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C9H12N2O2/c10-6-8(13-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H2,11,12) |
| InChIKey | KORQUGKYZSPJEG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-1-phenylethyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1-phenylethyl) carbamate?
The IUPAC name of (2-amino-1-phenylethyl) carbamate (CID 57066991) is (2-amino-1-phenylethyl) carbamate.
What is the SMILES notation for (2-amino-1-phenylethyl) carbamate?
The canonical SMILES for (2-amino-1-phenylethyl) carbamate is NCC(OC(N)=O)c1ccccc1.
What is the InChIKey of (2-amino-1-phenylethyl) carbamate?
The InChIKey is KORQUGKYZSPJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c10-6-8(13-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H2,11,12).
What are the key properties of (2-amino-1-phenylethyl) carbamate?
(2-amino-1-phenylethyl) carbamate has a molecular weight of 180.21 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1-phenylethyl) carbamate is sourced from PubChem (CID 57066991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).