C17H27N2O2+ — CID 54514526
[3-(1-ethylpiperidin-1-ium-1-yl)-1-phenylpropyl] carbamate (PubChem CID 54514526) has the molecular formula C17H27N2O2+ and a molecular weight of 291.41 g/mol. Its IUPAC name is [3-(1-ethylpiperidin-1-ium-1-yl)-1-phenylpropyl] carbamate.
| Compound Name | [3-(1-ethylpiperidin-1-ium-1-yl)-1-phenylpropyl] carbamate |
|---|---|
| PubChem CID | 54514526 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | [3-(1-ethylpiperidin-1-ium-1-yl)-1-phenylpropyl] carbamate |
| SMILES | CC[N+]1(CCC(OC(N)=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C17H26N2O2/c1-2-19(12-7-4-8-13-19)14-11-16(21-17(18)20)15-9-5-3-6-10-15/h3,5-6,9-10,16H,2,4,7-8,11-14H2,1H3,(H-,18,20)/p+1 |
| InChIKey | KMKXHLUJXCDARX-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|