About [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate
[2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate (PubChem CID 24845526) has the molecular formula C25H32NO5+
and a molecular weight of 426.53 g/mol. Its IUPAC name is [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate.
Molecular Properties
| Compound Name | [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate |
| PubChem CID | 24845526 |
| Molecular Formula | C25H32NO5+ |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate |
| SMILES | CCOC(=O)C[N+]1(CC(OC(=O)c2ccccc2OCC)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C25H32NO5/c1-3-29-22-15-9-8-14-21(22)25(28)31-23(20-12-6-5-7-13-20)18-26(16-10-11-17-26)19-24(27)30-4-2/h5-9,12-15,23H,3-4,10-11,16-19H2,1-2H3/q+1 |
| InChIKey | CFMNWNXQYVRONR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate?
The IUPAC name of [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate (CID 24845526) is [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate.
What is the SMILES notation for [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate?
The canonical SMILES for [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate is CCOC(=O)C[N+]1(CC(OC(=O)c2ccccc2OCC)c2ccccc2)CCCC1.
What is the InChIKey of [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate?
The InChIKey is CFMNWNXQYVRONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32NO5/c1-3-29-22-15-9-8-14-21(22)25(28)31-23(20-12-6-5-7-13-20)18-26(16-10-11-17-26)19-24(27)30-4-2/h5-9,12-15,23H,3-4,10-11,16-19H2,1-2H3/q+1.
What are the key properties of [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate?
[2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate has a molecular weight of 426.53 g/mol, XLogP of 4.16, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(2-ethoxy-2-oxoethyl)pyrrolidin-1-ium-1-yl]-1-phenylethyl] 2-ethoxybenzoate is sourced from PubChem (CID 24845526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).