C54H62O8 — CID 153322747
tetrakis(1-phenylpentyl) benzene-1,2,4,5-tetracarboxylate (PubChem CID 153322747) has the molecular formula C54H62O8 and a molecular weight of 839.08 g/mol. Its IUPAC name is tetrakis(1-phenylpentyl) benzene-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(1-phenylpentyl) benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 153322747 |
| Molecular Formula | C54H62O8 |
| Molecular Weight | 839.08 g/mol |
| Exact Mass | 838.44 |
| IUPAC Name | tetrakis(1-phenylpentyl) benzene-1,2,4,5-tetracarboxylate |
| SMILES | CCCCC(OC(=O)c1cc(C(=O)OC(CCCC)c2ccccc2)c(C(=O)OC(CCCC)c2ccccc2)cc1C(=O)OC(CCCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H62O8/c1-5-9-33-47(39-25-17-13-18-26-39)59-51(55)43-37-45(53(57)61-49(35-11-7-3)41-29-21-15-22-30-41)46(54(58)62-50(36-12-8-4)42-31-23-16-24-32-42)38-44(43)52(56)60-48(34-10-6-2)40-27-19-14-20-28-40/h13-32,37-38,47-50H,5-12,33-36H2,1-4H3 |
| InChIKey | AFNZTZLFTPEWDE-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.08 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|