C26H23NO5 — CID 142708152
ethyl 4-[3-(1,3-dioxoisoindol-2-yl)-1-phenylpropoxy]benzoate (PubChem CID 142708152) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is ethyl 4-[3-(1,3-dioxoisoindol-2-yl)-1-phenylpropoxy]benzoate.
| Compound Name | ethyl 4-[3-(1,3-dioxoisoindol-2-yl)-1-phenylpropoxy]benzoate |
|---|---|
| PubChem CID | 142708152 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 4-[3-(1,3-dioxoisoindol-2-yl)-1-phenylpropoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OC(CCN2C(=O)c3ccccc3C2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-2-31-26(30)19-12-14-20(15-13-19)32-23(18-8-4-3-5-9-18)16-17-27-24(28)21-10-6-7-11-22(21)25(27)29/h3-15,23H,2,16-17H2,1H3 |
| InChIKey | RXDAZFBZQAEHDK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|