C6H17N4O14P3 — CID 87536738
(3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;dicarbamoyloxyphosphoryl carbamate (PubChem CID 87536738) has the molecular formula C6H17N4O14P3 and a molecular weight of 462.14 g/mol. Its IUPAC name is (3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;dicarbamoyloxyphosphoryl carbamate.
| Compound Name | (3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;dicarbamoyloxyphosphoryl carbamate |
|---|---|
| PubChem CID | 87536738 |
| Molecular Formula | C6H17N4O14P3 |
| Molecular Weight | 462.14 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | (3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;dicarbamoyloxyphosphoryl carbamate |
| SMILES | NC(=O)OP(=O)(OC(N)=O)OC(N)=O.NCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H6N3O7P.C3H11NO7P2/c4-1(7)11-14(10,12-2(5)8)13-3(6)9;4-2-1-3(5,12(6,7)8)13(9,10)11/h(H2,4,7)(H2,5,8)(H2,6,9);5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11) |
| InChIKey | VVLJEQSXPDLTCU-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 335.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.14 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|