C15H34O14P2 — CID 88540379
[1-hydroxy-2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phosphonoethyl]phosphonic acid (PubChem CID 88540379) has the molecular formula C15H34O14P2 and a molecular weight of 500.37 g/mol. Its IUPAC name is [1-hydroxy-2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [1-hydroxy-2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 88540379 |
| Molecular Formula | C15H34O14P2 |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | [1-hydroxy-2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phosphonoethyl]phosphonic acid |
| SMILES | COCCOCCOCCOCCOCCOCCOCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C15H34O14P2/c1-23-2-3-24-4-5-25-6-7-26-8-9-27-10-11-28-12-13-29-14-15(16,30(17,18)19)31(20,21)22/h16H,2-14H2,1H3,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | NXWNCXKXCKMBNG-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 199.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|