C6H18N2O9P2 — CID 158245346
(3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;3-aminopropanoic acid (PubChem CID 158245346) has the molecular formula C6H18N2O9P2 and a molecular weight of 324.16 g/mol. Its IUPAC name is (3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;3-aminopropanoic acid.
| Compound Name | (3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;3-aminopropanoic acid |
|---|---|
| PubChem CID | 158245346 |
| Molecular Formula | C6H18N2O9P2 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (3-amino-1-hydroxy-1-phosphonopropyl)phosphonic acid;3-aminopropanoic acid |
| SMILES | NCCC(=O)O.NCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H11NO7P2.C3H7NO2/c4-2-1-3(5,12(6,7)8)13(9,10)11;4-2-1-3(5)6/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11);1-2,4H2,(H,5,6) |
| InChIKey | GGAXKIMSWIVBEW-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 224.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|