C4H13O7P2S+ — CID 16750060
(2-hydroxy-2,2-diphosphonoethyl)-dimethylsulfanium (PubChem CID 16750060) has the molecular formula C4H13O7P2S+ and a molecular weight of 267.16 g/mol. Its IUPAC name is (2-hydroxy-2,2-diphosphonoethyl)-dimethylsulfanium.
| Compound Name | (2-hydroxy-2,2-diphosphonoethyl)-dimethylsulfanium |
|---|---|
| PubChem CID | 16750060 |
| Molecular Formula | C4H13O7P2S+ |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | (2-hydroxy-2,2-diphosphonoethyl)-dimethylsulfanium |
| SMILES | C[S+](C)CC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H12O7P2S/c1-14(2)3-4(5,12(6,7)8)13(9,10)11/h5H,3H2,1-2H3,(H3-,6,7,8,9,10,11)/p+1 |
| InChIKey | JAYKFPQXXHDSSF-UHFFFAOYSA-O |
| XLogP | -1.13 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|