C5H15O9P3 — CID 22164393
[1-hydroxy-4-[hydroxy(methyl)phosphoryl]-1-phosphonobutyl]phosphonic acid (PubChem CID 22164393) has the molecular formula C5H15O9P3 and a molecular weight of 312.09 g/mol. Its IUPAC name is [1-hydroxy-4-[hydroxy(methyl)phosphoryl]-1-phosphonobutyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-[hydroxy(methyl)phosphoryl]-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 22164393 |
| Molecular Formula | C5H15O9P3 |
| Molecular Weight | 312.09 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | [1-hydroxy-4-[hydroxy(methyl)phosphoryl]-1-phosphonobutyl]phosphonic acid |
| SMILES | CP(=O)(O)CCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H15O9P3/c1-15(7,8)4-2-3-5(6,16(9,10)11)17(12,13)14/h6H,2-4H2,1H3,(H,7,8)(H2,9,10,11)(H2,12,13,14) |
| InChIKey | AZKJYSPSKJCJMQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.09 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|