C13H32NO7P2+ — CID 157356685
(10-hydroxy-10,10-diphosphonodecyl)-trimethylazanium (PubChem CID 157356685) has the molecular formula C13H32NO7P2+ and a molecular weight of 376.35 g/mol. Its IUPAC name is (10-hydroxy-10,10-diphosphonodecyl)-trimethylazanium.
| Compound Name | (10-hydroxy-10,10-diphosphonodecyl)-trimethylazanium |
|---|---|
| PubChem CID | 157356685 |
| Molecular Formula | C13H32NO7P2+ |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (10-hydroxy-10,10-diphosphonodecyl)-trimethylazanium |
| SMILES | C[N+](C)(C)CCCCCCCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H31NO7P2/c1-14(2,3)12-10-8-6-4-5-7-9-11-13(15,22(16,17)18)23(19,20)21/h15H,4-12H2,1-3H3,(H3-,16,17,18,19,20,21)/p+1 |
| InChIKey | XPHYQOYHJLRVIL-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|