C7H20NO7P2S+ — CID 54473860
(4-hydroxy-4,4-diphosphonobutyl)-dimethyl-(sulfanylmethyl)azanium (PubChem CID 54473860) has the molecular formula C7H20NO7P2S+ and a molecular weight of 324.25 g/mol. Its IUPAC name is (4-hydroxy-4,4-diphosphonobutyl)-dimethyl-(sulfanylmethyl)azanium.
| Compound Name | (4-hydroxy-4,4-diphosphonobutyl)-dimethyl-(sulfanylmethyl)azanium |
|---|---|
| PubChem CID | 54473860 |
| Molecular Formula | C7H20NO7P2S+ |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (4-hydroxy-4,4-diphosphonobutyl)-dimethyl-(sulfanylmethyl)azanium |
| SMILES | C[N+](C)(CS)CCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H19NO7P2S/c1-8(2,6-18)5-3-4-7(9,16(10,11)12)17(13,14)15/h9H,3-6H2,1-2H3,(H4-,10,11,12,13,14,15,18)/p+1 |
| InChIKey | XKELLFANRDPDIV-UHFFFAOYSA-O |
| XLogP | -0.27 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|