C9H24ClNO7P2S — CID 159749652
diethyl-(4-hydroxy-4,4-diphosphonobutyl)-(sulfanylmethyl)azanium chloride (PubChem CID 159749652) has the molecular formula C9H24ClNO7P2S and a molecular weight of 387.76 g/mol. Its IUPAC name is diethyl-(4-hydroxy-4,4-diphosphonobutyl)-(sulfanylmethyl)azanium chloride.
| Compound Name | diethyl-(4-hydroxy-4,4-diphosphonobutyl)-(sulfanylmethyl)azanium chloride |
|---|---|
| PubChem CID | 159749652 |
| Molecular Formula | C9H24ClNO7P2S |
| Molecular Weight | 387.76 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | diethyl-(4-hydroxy-4,4-diphosphonobutyl)-(sulfanylmethyl)azanium chloride |
| SMILES | CC[N+](CC)(CS)CCCC(O)(P(=O)(O)O)P(=O)(O)O.[Cl-] |
| InChI | InChI=1S/C9H23NO7P2S.ClH/c1-3-10(4-2,8-20)7-5-6-9(11,18(12,13)14)19(15,16)17;/h11H,3-8H2,1-2H3,(H4-,12,13,14,15,16,17,20);1H |
| InChIKey | NDMIVICGHNZFCS-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.76 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|