C5H14O10P2S — CID 19091195
5-hydroxy-5,5-diphosphonopentane-1-sulfonic acid (PubChem CID 19091195) has the molecular formula C5H14O10P2S and a molecular weight of 328.17 g/mol. Its IUPAC name is 5-hydroxy-5,5-diphosphonopentane-1-sulfonic acid.
| Compound Name | 5-hydroxy-5,5-diphosphonopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 19091195 |
| Molecular Formula | C5H14O10P2S |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 5-hydroxy-5,5-diphosphonopentane-1-sulfonic acid |
| SMILES | O=P(O)(O)C(O)(CCCCS(=O)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H14O10P2S/c6-5(16(7,8)9,17(10,11)12)3-1-2-4-18(13,14)15/h6H,1-4H2,(H2,7,8,9)(H2,10,11,12)(H,13,14,15) |
| InChIKey | KPMFOXPKOBKKQN-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|