C5H14O8P2 — CID 14325355
(2,4-dihydroxy-4-phosphonopentan-2-yl)phosphonic acid (PubChem CID 14325355) has the molecular formula C5H14O8P2 and a molecular weight of 264.11 g/mol. Its IUPAC name is (2,4-dihydroxy-4-phosphonopentan-2-yl)phosphonic acid.
| Compound Name | (2,4-dihydroxy-4-phosphonopentan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 14325355 |
| Molecular Formula | C5H14O8P2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | (2,4-dihydroxy-4-phosphonopentan-2-yl)phosphonic acid |
| SMILES | CC(O)(CC(C)(O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H14O8P2/c1-4(6,14(8,9)10)3-5(2,7)15(11,12)13/h6-7H,3H2,1-2H3,(H2,8,9,10)(H2,11,12,13) |
| InChIKey | JDAVFCUINKUYDT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|