About 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc
2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc (PubChem CID 87107997) has the molecular formula C8H20O6P2Zn
and a molecular weight of 339.58 g/mol. Its IUPAC name is 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc.
Molecular Properties
| Compound Name | 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc |
| PubChem CID | 87107997 |
| Molecular Formula | C8H20O6P2Zn |
| Molecular Weight | 339.58 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc |
| SMILES | CC(C)(O)P(=O)(O)CCP(=O)(O)C(C)(C)O.[Zn] |
| InChI | InChI=1S/C8H20O6P2.Zn/c1-7(2,9)15(11,12)5-6-16(13,14)8(3,4)10;/h9-10H,5-6H2,1-4H3,(H,11,12)(H,13,14); |
| InChIKey | GNEHGWOLIAWZAH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc?
The IUPAC name of 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc (CID 87107997) is 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc.
What is the SMILES notation for 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc?
The canonical SMILES for 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc is CC(C)(O)P(=O)(O)CCP(=O)(O)C(C)(C)O.[Zn].
What is the InChIKey of 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc?
The InChIKey is GNEHGWOLIAWZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O6P2.Zn/c1-7(2,9)15(11,12)5-6-16(13,14)8(3,4)10;/h9-10H,5-6H2,1-4H3,(H,11,12)(H,13,14);.
What are the key properties of 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc?
2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc has a molecular weight of 339.58 g/mol, XLogP of 0.98, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[hydroxy(2-hydroxypropan-2-yl)phosphoryl]ethyl-(2-hydroxypropan-2-yl)phosphinic acid;zinc is sourced from PubChem (CID 87107997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).