3,3-dimethylbutylphosphonic acid

C6H15O3P — CID 15402429

IUPAC3,3-dimethylbutylphosphonic acid
SMILESCC(C)(C)CCP(=O)(O)O
InChIInChI=1S/C6H15O3P/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3,(H2,7,8,9)
InChIKeyBJWNRQMDECXKTE-UHFFFAOYSA-N
MW166.16 g/mol
LogP1.60
Rot. Bonds2

About 3,3-dimethylbutylphosphonic acid

3,3-dimethylbutylphosphonic acid (PubChem CID 15402429) has the molecular formula C6H15O3P and a molecular weight of 166.16 g/mol. Its IUPAC name is 3,3-dimethylbutylphosphonic acid.

Molecular Properties

Compound Name3,3-dimethylbutylphosphonic acid
PubChem CID15402429
Molecular FormulaC6H15O3P
Molecular Weight166.16 g/mol
Exact Mass166.08
IUPAC Name3,3-dimethylbutylphosphonic acid
SMILESCC(C)(C)CCP(=O)(O)O
InChIInChI=1S/C6H15O3P/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3,(H2,7,8,9)
InChIKeyBJWNRQMDECXKTE-UHFFFAOYSA-N
XLogP1.60
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.16
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3,3-dimethylbutylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylbutylphosphonic acid?
The IUPAC name of 3,3-dimethylbutylphosphonic acid (CID 15402429) is 3,3-dimethylbutylphosphonic acid.
What is the SMILES notation for 3,3-dimethylbutylphosphonic acid?
The canonical SMILES for 3,3-dimethylbutylphosphonic acid is CC(C)(C)CCP(=O)(O)O.
What is the InChIKey of 3,3-dimethylbutylphosphonic acid?
The InChIKey is BJWNRQMDECXKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15O3P/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3,(H2,7,8,9).
What are the key properties of 3,3-dimethylbutylphosphonic acid?
3,3-dimethylbutylphosphonic acid has a molecular weight of 166.16 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutylphosphonic acid is sourced from PubChem (CID 15402429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).