C7H15FNO5P — CID 158798368
2-amino-3-fluoro-2,3-dimethyl-5-phosphonopentanoic acid (PubChem CID 158798368) has the molecular formula C7H15FNO5P and a molecular weight of 243.17 g/mol. Its IUPAC name is 2-amino-3-fluoro-2,3-dimethyl-5-phosphonopentanoic acid.
| Compound Name | 2-amino-3-fluoro-2,3-dimethyl-5-phosphonopentanoic acid |
|---|---|
| PubChem CID | 158798368 |
| Molecular Formula | C7H15FNO5P |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-amino-3-fluoro-2,3-dimethyl-5-phosphonopentanoic acid |
| SMILES | CC(F)(CCP(=O)(O)O)C(C)(N)C(=O)O |
| InChI | InChI=1S/C7H15FNO5P/c1-6(8,3-4-15(12,13)14)7(2,9)5(10)11/h3-4,9H2,1-2H3,(H,10,11)(H2,12,13,14) |
| InChIKey | ITDPIXACOCZRBU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|