C6H13F3INO2 — CID 173177783
2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide (PubChem CID 173177783) has the molecular formula C6H13F3INO2 and a molecular weight of 315.07 g/mol. Its IUPAC name is 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide.
| Compound Name | 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide |
|---|---|
| PubChem CID | 173177783 |
| Molecular Formula | C6H13F3INO2 |
| Molecular Weight | 315.07 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide |
| SMILES | CC(C)(C)N.I.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H11N.C2HF3O2.HI/c1-4(2,3)5;3-2(4,5)1(6)7;/h5H2,1-3H3;(H,6,7);1H |
| InChIKey | QWDCTMMBZOLFEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|