About 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide
2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide (PubChem CID 173177783) has the molecular formula C6H13F3INO2
and a molecular weight of 315.07 g/mol. Its IUPAC name is 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide.
Molecular Properties
| Compound Name | 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide |
| PubChem CID | 173177783 |
| Molecular Formula | C6H13F3INO2 |
| Molecular Weight | 315.07 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide |
| SMILES | CC(C)(C)N.I.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H11N.C2HF3O2.HI/c1-4(2,3)5;3-2(4,5)1(6)7;/h5H2,1-3H3;(H,6,7);1H |
| InChIKey | QWDCTMMBZOLFEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide?
The IUPAC name of 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide (CID 173177783) is 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide.
What is the SMILES notation for 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide?
The canonical SMILES for 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide is CC(C)(C)N.I.O=C(O)C(F)(F)F.
What is the InChIKey of 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide?
The InChIKey is QWDCTMMBZOLFEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C2HF3O2.HI/c1-4(2,3)5;3-2(4,5)1(6)7;/h5H2,1-3H3;(H,6,7);1H.
What are the key properties of 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide?
2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide has a molecular weight of 315.07 g/mol, XLogP of 1.99, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-2-amine;2,2,2-trifluoroacetic acid;hydroiodide is sourced from PubChem (CID 173177783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).