C9H16F6N2O4 — CID 171930864
2-methylbutane-2,3-diamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171930864) has the molecular formula C9H16F6N2O4 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-methylbutane-2,3-diamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-methylbutane-2,3-diamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171930864 |
| Molecular Formula | C9H16F6N2O4 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-methylbutane-2,3-diamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(N)C(C)(C)N.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H14N2.2C2HF3O2/c1-4(6)5(2,3)7;2*3-2(4,5)1(6)7/h4H,6-7H2,1-3H3;2*(H,6,7) |
| InChIKey | KMVHEONXEVXVTA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |