C9H16F3NO3 — CID 87235210
(2S,3S)-2-amino-3-methylhex-5-en-3-ol;2,2,2-trifluoroacetic acid (PubChem CID 87235210) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methylhex-5-en-3-ol;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3S)-2-amino-3-methylhex-5-en-3-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87235210 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (2S,3S)-2-amino-3-methylhex-5-en-3-ol;2,2,2-trifluoroacetic acid |
| SMILES | C=CC[C@](C)(O)[C@H](C)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H15NO.C2HF3O2/c1-4-5-7(3,9)6(2)8;3-2(4,5)1(6)7/h4,6,9H,1,5,8H2,2-3H3;(H,6,7)/t6-,7-;/m0./s1 |
| InChIKey | NYSPAARHIMHKOG-LEUCUCNGSA-N |
| XLogP | 1.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|