C7H11F3O3S — CID 162316692
2,2-dimethylpropanethioic S-acid;2,2,2-trifluoroacetic acid (PubChem CID 162316692) has the molecular formula C7H11F3O3S and a molecular weight of 232.22 g/mol. Its IUPAC name is 2,2-dimethylpropanethioic S-acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2,2-dimethylpropanethioic S-acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162316692 |
| Molecular Formula | C7H11F3O3S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2,2-dimethylpropanethioic S-acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)C(=O)S.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H10OS.C2HF3O2/c1-5(2,3)4(6)7;3-2(4,5)1(6)7/h1-3H3,(H,6,7);(H,6,7) |
| InChIKey | IPQIDZTYSITPRI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|