2-phosphono-2-(2-phosphonoethyl)butanedioic acid

C6H12O10P2 — CID 12543052

IUPAC2-phosphono-2-(2-phosphonoethyl)butanedioic acid
SMILESO=C(O)CC(CCP(=O)(O)O)(C(=O)O)P(=O)(O)O
InChIInChI=1S/C6H12O10P2/c7-4(8)3-6(5(9)10,18(14,15)16)1-2-17(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13)(H2,14,15,16)
InChIKeyFVELLNXPMFCHQJ-UHFFFAOYSA-N
MW306.10 g/mol
LogP-0.97
Rot. Bonds7

About 2-phosphono-2-(2-phosphonoethyl)butanedioic acid

2-phosphono-2-(2-phosphonoethyl)butanedioic acid (PubChem CID 12543052) has the molecular formula C6H12O10P2 and a molecular weight of 306.10 g/mol. Its IUPAC name is 2-phosphono-2-(2-phosphonoethyl)butanedioic acid.

Molecular Properties

Compound Name2-phosphono-2-(2-phosphonoethyl)butanedioic acid
PubChem CID12543052
Molecular FormulaC6H12O10P2
Molecular Weight306.10 g/mol
Exact Mass305.99
IUPAC Name2-phosphono-2-(2-phosphonoethyl)butanedioic acid
SMILESO=C(O)CC(CCP(=O)(O)O)(C(=O)O)P(=O)(O)O
InChIInChI=1S/C6H12O10P2/c7-4(8)3-6(5(9)10,18(14,15)16)1-2-17(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13)(H2,14,15,16)
InChIKeyFVELLNXPMFCHQJ-UHFFFAOYSA-N
XLogP-0.97
TPSA189.66 Ų
H-Bond Donors6
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.10
LogP ≤ 5-0.97
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-phosphono-2-(2-phosphonoethyl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[2-[hydroxy(methyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid
CID 88765234
acetic acid;2-phosphonobutane-1,2,4-tricarboxylic acid
CID 172728107
2-[2-[hydroxy(phenyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid
CID 88765115
(3,4-dicarboxy-3-phosphonobutanoyl)-trihydroxyphosphanium
CID 57110164
2-ethyl-2-phosphonobutanedioic acid;4-phosphonobutane-1,2,3-tricarboxylic acid
CID 139534760
(2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride
CID 53313139
2-ethyl-2-phosphonohexanoic acid
CID 88688583
2-hydroxypropane-1,2,3-tricarboxylic acid;2-phosphonoacetic acid
CID 118416602
3-(carboxymethylamino)-3,3-diphosphonopropanoic acid
CID 54364887
2-methyl-2-nitroso-5-phosphonopentanoic acid
CID 174409402
2-(1,1-diphosphonoethyl)-2-methylbutanedioic acid
CID 21245624
3-phosphonopropanoic acid;zirconium
CID 88720720

Frequently Asked Questions

What is the IUPAC name of 2-phosphono-2-(2-phosphonoethyl)butanedioic acid?
The IUPAC name of 2-phosphono-2-(2-phosphonoethyl)butanedioic acid (CID 12543052) is 2-phosphono-2-(2-phosphonoethyl)butanedioic acid.
What is the SMILES notation for 2-phosphono-2-(2-phosphonoethyl)butanedioic acid?
The canonical SMILES for 2-phosphono-2-(2-phosphonoethyl)butanedioic acid is O=C(O)CC(CCP(=O)(O)O)(C(=O)O)P(=O)(O)O.
What is the InChIKey of 2-phosphono-2-(2-phosphonoethyl)butanedioic acid?
The InChIKey is FVELLNXPMFCHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O10P2/c7-4(8)3-6(5(9)10,18(14,15)16)1-2-17(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13)(H2,14,15,16).
What are the key properties of 2-phosphono-2-(2-phosphonoethyl)butanedioic acid?
2-phosphono-2-(2-phosphonoethyl)butanedioic acid has a molecular weight of 306.10 g/mol, XLogP of -0.97, 7 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphono-2-(2-phosphonoethyl)butanedioic acid is sourced from PubChem (CID 12543052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).